CAS 27738-91-6 appears in our catalog under these names: Bis(4-chlorosulfonylphenyl)disulfide, 95%, 95%, 4,4'-Disulfanediyldibenzenesulfonyl chloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-[(4-chlorosulfonylphenyl)disulfanyl]benzenesulfonyl chloride (CAS 27738-91-6) is a chemical compound with the molecular formula C12H8Cl2O4S4 and a molecular weight of 415.4 g/mol. IUPAC name: 4-[(4-chlorosulfonylphenyl)disulfanyl]benzenesulfonyl chloride. InChIKey: VUKZJNCBRXLCAA-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O4S4 |
|---|---|
| Molecular weight | 415.4 g/mol |
| IUPAC name | 4-[(4-chlorosulfonylphenyl)disulfanyl]benzenesulfonyl chloride |
| InChIKey | VUKZJNCBRXLCAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1SSC2=CC=C(C=C2)S(=O)(=O)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)