CAS 2775292-24-3 appears in our catalog under these names: N–desethyl Brinzolamide (oxalate), N-desethyl Brinzolamide (oxalate), 95%, 95%, N-Desethyl Brinzolamide (oxalate). Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 5 mg, 1 mg, 25 mg, 10 mg.
(4R)-4-amino-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide;oxalic acid (CAS 2775292-24-3) is a chemical compound with the molecular formula C12H19N3O9S3 and a molecular weight of 445.5 g/mol. IUPAC name: (4R)-4-amino-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide;oxalic acid. InChIKey: SADPWQTWTRQXLQ-QRPNPIFTSA-N.
| Molecular formula | C12H19N3O9S3 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | (4R)-4-amino-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide;oxalic acid |
| InChIKey | SADPWQTWTRQXLQ-QRPNPIFTSA-N |
| SMILES | COCCCN1C[C@@H](C2=C(S1(=O)=O)SC(=C2)S(=O)(=O)N)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)