CAS 2776232-83-6 is the registry number for Potassium trifluoro(pentan-3-yl)borate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Potassium trifluoro(pentan-3-yl)boranuide (CAS 2776232-83-6) is a chemical compound with the molecular formula C5H11BF3K and a molecular weight of 178.05 g/mol. IUPAC name: potassium trifluoro(pentan-3-yl)boranuide. InChIKey: OMFCOPPAXDRPLK-UHFFFAOYSA-N.
| Molecular formula | C5H11BF3K |
|---|---|
| Molecular weight | 178.05 g/mol |
| IUPAC name | potassium trifluoro(pentan-3-yl)boranuide |
| InChIKey | OMFCOPPAXDRPLK-UHFFFAOYSA-N |
| SMILES | [B-](C(CC)CC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)