Products 277758-55-1

CAS 277758-55-1 is the registry number for 4-(1-Oxoisoindolin-2-yl)-2-propoxybenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(1,3-dioxoisoindol-2-yl)-2-propoxybenzenesulfonyl chloride (CAS 277758-55-1) is a chemical compound with the molecular formula C17H14ClNO5S and a molecular weight of 379.8 g/mol. IUPAC name: 4-(1,3-dioxoisoindol-2-yl)-2-propoxybenzenesulfonyl chloride. InChIKey: BFMSRWCVFIWETF-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14ClNO5S
Molecular weight379.8 g/mol
IUPAC name4-(1,3-dioxoisoindol-2-yl)-2-propoxybenzenesulfonyl chloride
InChIKeyBFMSRWCVFIWETF-UHFFFAOYSA-N
SMILESCCCOC1=C(C=CC(=C1)N2C(=O)C3=CC=CC=C3C2=O)S(=O)(=O)Cl

Computed by PubChem (NCBI)