CAS 277758-55-1 is the registry number for 4-(1-Oxoisoindolin-2-yl)-2-propoxybenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,3-dioxoisoindol-2-yl)-2-propoxybenzenesulfonyl chloride (CAS 277758-55-1) is a chemical compound with the molecular formula C17H14ClNO5S and a molecular weight of 379.8 g/mol. IUPAC name: 4-(1,3-dioxoisoindol-2-yl)-2-propoxybenzenesulfonyl chloride. InChIKey: BFMSRWCVFIWETF-UHFFFAOYSA-N.
| Molecular formula | C17H14ClNO5S |
|---|---|
| Molecular weight | 379.8 g/mol |
| IUPAC name | 4-(1,3-dioxoisoindol-2-yl)-2-propoxybenzenesulfonyl chloride |
| InChIKey | BFMSRWCVFIWETF-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=CC(=C1)N2C(=O)C3=CC=CC=C3C2=O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)