CAS 27808-46-4 appears in our catalog under these names: 4-Methylbenzo(c)(1,2,5)oxadiazole 1-oxide, 95%, 4-Methyl-2,1,3-benzoxadiazol-1-ium-1-olate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-methyl-1-oxido-2,1,3-benzoxadiazol-1-ium (CAS 27808-46-4) is a chemical compound with the molecular formula C7H6N2O2 and a molecular weight of 150.13 g/mol. IUPAC name: 4-methyl-1-oxido-2,1,3-benzoxadiazol-1-ium. InChIKey: MTRATWQOBZWRTD-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O2 |
|---|---|
| Molecular weight | 150.13 g/mol |
| IUPAC name | 4-methyl-1-oxido-2,1,3-benzoxadiazol-1-ium |
| InChIKey | MTRATWQOBZWRTD-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC2=[N+](ON=C12)[O-] |
Computed by PubChem (NCBI)