Products 2780972-41-8
CAS 2780972-41-8 is the registry number for tert-Butyl 4-[[1-(4-nitrophenyl)piperidin-4-yl]amino]piperidine-1-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl 4-[[1-(4-nitrophenyl)piperidin-4-yl]amino]piperidine-1-carboxylate (CAS 2780972-41-8) is a chemical compound with the molecular formula C21H32N4O4 and a molecular weight of 404.5 g/mol. IUPAC name: tert-butyl 4-[[1-(4-nitrophenyl)piperidin-4-yl]amino]piperidine-1-carboxylate. InChIKey: SPYUCGVZWBCDCR-UHFFFAOYSA-N.
| Molecular formula | C21H32N4O4 |
|---|---|
| Molecular weight | 404.5 g/mol |
| IUPAC name | tert-butyl 4-[[1-(4-nitrophenyl)piperidin-4-yl]amino]piperidine-1-carboxylate |
| InChIKey | SPYUCGVZWBCDCR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)NC2CCN(CC2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)