CAS 278175-81-8 is the registry number for (2,2'-BIpyridine-κN1,κN1')[ethanedioato(2-)-κO1,κO2]zinc, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Zinc;oxalate;2-pyridin-2-ylpyridine (CAS 278175-81-8) is a chemical compound with the molecular formula C12H8N2O4Zn and a molecular weight of 309.6 g/mol. IUPAC name: zinc;oxalate;2-pyridin-2-ylpyridine. InChIKey: HZDXKTHDONIFNS-UHFFFAOYSA-L.
| Molecular formula | C12H8N2O4Zn |
|---|---|
| Molecular weight | 309.6 g/mol |
| IUPAC name | zinc;oxalate;2-pyridin-2-ylpyridine |
| InChIKey | HZDXKTHDONIFNS-UHFFFAOYSA-L |
| SMILES | C1=CC=NC(=C1)C2=CC=CC=N2.C(=O)(C(=O)[O-])[O-].[Zn+2] |
Computed by PubChem (NCBI)