CAS 2785323-61-5 appears in our catalog under these names: Metazachlor 3-Mercaptolactic Acid Conjugate Sulfoxide, Metazachlor Metabolite M479H016, Metazachlor Metabolite 479M16, Metazachlor Metabolite 479M16, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Sigma-Aldrich, HPC Standards. Available pack sizes: 50mg, 10MG, 1x10mg, 1x1ml.
3-[2-[2,6-dimethyl-N-(pyrazol-1-ylmethyl)anilino]-2-oxoethyl]sulfinyl-2-hydroxypropanoic acid (CAS 2785323-61-5) is a chemical compound with the molecular formula C17H21N3O5S and a molecular weight of 379.4 g/mol. IUPAC name: 3-[2-[2,6-dimethyl-N-(pyrazol-1-ylmethyl)anilino]-2-oxoethyl]sulfinyl-2-hydroxypropanoic acid. InChIKey: RTFJGJZKLFURCR-UHFFFAOYSA-N.
| Molecular formula | C17H21N3O5S |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 3-[2-[2,6-dimethyl-N-(pyrazol-1-ylmethyl)anilino]-2-oxoethyl]sulfinyl-2-hydroxypropanoic acid |
| InChIKey | RTFJGJZKLFURCR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)N(CN2C=CC=N2)C(=O)CS(=O)CC(C(=O)O)O |
Computed by PubChem (NCBI)