CAS 2785346-75-8 appears in our catalog under these names: N-Pyrrolidino Etonitazene, N–Pyrrolidino Etonitazene (exempt preparation). Offered by: TRC, GLPBio. Available pack sizes: 25mg, 1mg.
2-[(4-ethoxyphenyl)methyl]-5-nitro-1-(2-pyrrolidin-1-ylethyl)benzimidazole (CAS 2785346-75-8) is a chemical compound with the molecular formula C22H26N4O3 and a molecular weight of 394.5 g/mol. IUPAC name: 2-[(4-ethoxyphenyl)methyl]-5-nitro-1-(2-pyrrolidin-1-ylethyl)benzimidazole. InChIKey: LQZWZCJCEPUKCJ-UHFFFAOYSA-N.
| Molecular formula | C22H26N4O3 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | 2-[(4-ethoxyphenyl)methyl]-5-nitro-1-(2-pyrrolidin-1-ylethyl)benzimidazole |
| InChIKey | LQZWZCJCEPUKCJ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)CC2=NC3=C(N2CCN4CCCC4)C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)