CAS 2786-31-4 appears in our catalog under these names: 3-Methylbenzothiazolium iodide, 95%, 3-Methylbenzothiazolium Iodide, 98%, 3–Methylbenzothiazolium Iodide, 3-Methylbenzothiazolium Iodide 95%, 3-Methylbenzothiazolium Iodide, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g, 250g, 500g.
3-methyl-1,3-benzothiazol-3-ium iodide (CAS 2786-31-4) is a chemical compound with the molecular formula C8H8INS and a molecular weight of 277.13 g/mol. IUPAC name: 3-methyl-1,3-benzothiazol-3-ium iodide. InChIKey: SGYIRNXZLWJMCR-UHFFFAOYSA-M.
| Molecular formula | C8H8INS |
|---|---|
| Molecular weight | 277.13 g/mol |
| IUPAC name | 3-methyl-1,3-benzothiazol-3-ium iodide |
| InChIKey | SGYIRNXZLWJMCR-UHFFFAOYSA-M |
| SMILES | C[N+]1=CSC2=CC=CC=C21.[I-] |
Computed by PubChem (NCBI)