CAS 27860-55-5 appears in our catalog under these names: Vanadyl octaethylporphine, 95%, Vanadyl octaethylporphine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg, 25mg.
2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide;oxovanadium(2+) (CAS 27860-55-5) is a chemical compound with the molecular formula C36H44N4OV and a molecular weight of 599.7 g/mol. IUPAC name: 2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide;oxovanadium(2+). InChIKey: XIJDRZKWTNMUAR-UHFFFAOYSA-N.
| Molecular formula | C36H44N4OV |
|---|---|
| Molecular weight | 599.7 g/mol |
| IUPAC name | 2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide;oxovanadium(2+) |
| InChIKey | XIJDRZKWTNMUAR-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=CC3=NC(=CC4=C(C(=C([N-]4)C=C5C(=C(C(=N5)C=C1[N-]2)CC)CC)CC)CC)C(=C3CC)CC)CC.O=[V+2] |
Computed by PubChem (NCBI)