CAS 2787498-69-3 is the registry number for Rel-tert-butyl (5R,7S,8S)-8-amino-7-methyl-2-azaspiro[4.5]decane-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (5R,7S,8S)-8-amino-7-methyl-2-azaspiro[4.5]decane-2-carboxylate (CAS 2787498-69-3) is a chemical compound with the molecular formula C15H28N2O2 and a molecular weight of 268.39 g/mol. IUPAC name: tert-butyl (5R,7S,8S)-8-amino-7-methyl-2-azaspiro[4.5]decane-2-carboxylate. InChIKey: NNIRLEVIHYOXKG-HUBLWGQQSA-N.
| Molecular formula | C15H28N2O2 |
|---|---|
| Molecular weight | 268.39 g/mol |
| IUPAC name | tert-butyl (5R,7S,8S)-8-amino-7-methyl-2-azaspiro[4.5]decane-2-carboxylate |
| InChIKey | NNIRLEVIHYOXKG-HUBLWGQQSA-N |
| SMILES | C[C@H]1C[C@]2(CC[C@@H]1N)CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)