CAS 2787548-58-5 is the registry number for STAT3-IN-47. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]benzo[f][1]benzofuran-4,9-dione (CAS 2787548-58-5) is a chemical compound with the molecular formula C15H8N4O3S and a molecular weight of 324.3 g/mol. IUPAC name: 2-[(5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]benzo[f][1]benzofuran-4,9-dione. InChIKey: PACUCJMVMSDZNL-UHFFFAOYSA-N.
| Molecular formula | C15H8N4O3S |
|---|---|
| Molecular weight | 324.3 g/mol |
| IUPAC name | 2-[(5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]benzo[f][1]benzofuran-4,9-dione |
| InChIKey | PACUCJMVMSDZNL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)OC(=C3)C=NN4C=NNC4=S |
Computed by PubChem (NCBI)