CAS 27878-37-1 appears in our catalog under these names: 2-Aminoindole hydrochloride, 95%, 2-Aminoindole Hydrochloride, >95% (HPLC), 2-Aminoindole hydrochloride, 1H-Indol-2-amine hydrochloride 98%, 1H-Indol-2-amine hydrochloride, 98%, 98%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 500mg, 50mg, 25mg, 100mg.
1H-indol-2-amine;hydrochloride (CAS 27878-37-1) is a chemical compound with the molecular formula C8H9ClN2 and a molecular weight of 168.62 g/mol. IUPAC name: 1H-indol-2-amine;hydrochloride. InChIKey: JIKSXSUBAADKKK-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2 |
|---|---|
| Molecular weight | 168.62 g/mol |
| IUPAC name | 1H-indol-2-amine;hydrochloride |
| InChIKey | JIKSXSUBAADKKK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)N.Cl |
Computed by PubChem (NCBI)