CAS 2787822-13-1 is the registry number for Isopropyl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate. Offered by: TRC. Available pack sizes: 250mg.
Propan-2-yl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate (CAS 2787822-13-1) is a chemical compound with the molecular formula C20H26N2O5S and a molecular weight of 406.5 g/mol. IUPAC name: propan-2-yl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate. InChIKey: QIPGMPFHUXPGIO-UHFFFAOYSA-N.
| Molecular formula | C20H26N2O5S |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | propan-2-yl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate |
| InChIKey | QIPGMPFHUXPGIO-UHFFFAOYSA-N |
| SMILES | CCCCNC1=C(C(=CC(=C1)C(=O)OC(C)C)S(=O)(=O)N)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)