CAS 2789-43-7 is the registry number for 4alpha-Methyl-5alpha-cholest-7-en-3-one. Offered by: TRC. Available pack sizes: 5mg.
4alpha-methyllathosterone is a cholestanoid that is lathosterone bearing an alpha-methyl substituent at position 4. It derives from a hydride of a 5alpha-cholestane.
Source: ChEBI
| Molecular formula | C28H46O |
|---|---|
| Molecular weight | 398.7 g/mol |
| IUPAC name | (4S,5S,9R,10S,13R,14R,17R)-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| InChIKey | OWKGVPXWOHLTSL-LIUJFMQASA-N |
| SMILES | C[C@H]1[C@@H]2CC=C3[C@@H]4CC[C@@H]([C@]4(CC[C@@H]3[C@]2(CCC1=O)C)C)[C@H](C)CCCC(C)C |
Computed by PubChem (NCBI)