CAS 2789616-13-1 appears in our catalog under these names: 4,6-Dibromo-2-fluoro-1,3-benzenediacetonitrile, 95%, 95%, 2,2'-(4,6-Dibromo-2-fluoro-1,3-phenylene)diacetonitrile, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g, 25g.
2-[4,6-dibromo-3-(cyanomethyl)-2-fluorophenyl]acetonitrile (CAS 2789616-13-1) is a chemical compound with the molecular formula C10H5Br2FN2 and a molecular weight of 331.97 g/mol. IUPAC name: 2-[4,6-dibromo-3-(cyanomethyl)-2-fluorophenyl]acetonitrile. InChIKey: SOQYSGQZCRYFDF-UHFFFAOYSA-N.
| Molecular formula | C10H5Br2FN2 |
|---|---|
| Molecular weight | 331.97 g/mol |
| IUPAC name | 2-[4,6-dibromo-3-(cyanomethyl)-2-fluorophenyl]acetonitrile |
| InChIKey | SOQYSGQZCRYFDF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)CC#N)F)CC#N)Br |
Computed by PubChem (NCBI)