CAS 2789682-27-3 is the registry number for 2'-Bromo-5'-methyl-5',6'-dihydro-4'H-spiro[cyclopentane-1,7'-thieno[3,2-c]pyridin]-4'-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5-methylspiro[6H-thieno[3,2-c]pyridine-7,1'-cyclopentane]-4-one (CAS 2789682-27-3) is a chemical compound with the molecular formula C12H14BrNOS and a molecular weight of 300.22 g/mol. IUPAC name: 2-bromo-5-methylspiro[6H-thieno[3,2-c]pyridine-7,1'-cyclopentane]-4-one. InChIKey: HNYNJTHBCQMEBX-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNOS |
|---|---|
| Molecular weight | 300.22 g/mol |
| IUPAC name | 2-bromo-5-methylspiro[6H-thieno[3,2-c]pyridine-7,1'-cyclopentane]-4-one |
| InChIKey | HNYNJTHBCQMEBX-UHFFFAOYSA-N |
| SMILES | CN1CC2(CCCC2)C3=C(C1=O)C=C(S3)Br |
Computed by PubChem (NCBI)