Products 2789697-52-3
CAS 2789697-52-3 is the registry number for Zeltociclib, 99.33%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 100 mg, 10mM/1mL, 25 mg, 10 mg, 50 mg.
(2S)-2-[[4-(7-dimethylphosphoryl-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]propan-1-ol (CAS 2789697-52-3) is a chemical compound with the molecular formula C18H20F3N4O2P and a molecular weight of 412.3 g/mol. IUPAC name: (2S)-2-[[4-(7-dimethylphosphoryl-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]propan-1-ol. InChIKey: PDAXWGPFSFSARG-JTQLQIEISA-N.
| Molecular formula | C18H20F3N4O2P |
|---|---|
| Molecular weight | 412.3 g/mol |
| IUPAC name | (2S)-2-[[4-(7-dimethylphosphoryl-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]propan-1-ol |
| InChIKey | PDAXWGPFSFSARG-JTQLQIEISA-N |
| SMILES | C[C@@H](CO)NC1=NC=C(C(=N1)C2=CNC3=C2C=CC=C3P(=O)(C)C)C(F)(F)F |
Computed by PubChem (NCBI)