CAS 2789711-40-4 is the registry number for RIPK2-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-(4-aminocyclohexyl)-5-(2-fluoro-4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine (CAS 2789711-40-4) is a chemical compound with the molecular formula C19H22FN5 and a molecular weight of 339.4 g/mol. IUPAC name: 7-(4-aminocyclohexyl)-5-(2-fluoro-4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: DSKYHEJWWIBREA-UHFFFAOYSA-N.
| Molecular formula | C19H22FN5 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 7-(4-aminocyclohexyl)-5-(2-fluoro-4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | DSKYHEJWWIBREA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CN(C3=NC=NC(=C23)N)C4CCC(CC4)N)F |
Computed by PubChem (NCBI)