Products 2790095-60-0
CAS 2790095-60-0 is the registry number for N-((4-Bromophenyl)sulfonyl)-3-methylbutanamide, 98%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 100mg, 1g.
N-(4-bromophenyl)sulfonyl-3-methylbutanamide (CAS 2790095-60-0) is a chemical compound with the molecular formula C11H14BrNO3S and a molecular weight of 320.20 g/mol. IUPAC name: N-(4-bromophenyl)sulfonyl-3-methylbutanamide. InChIKey: YHMHTNHUCODKGY-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO3S |
|---|---|
| Molecular weight | 320.20 g/mol |
| IUPAC name | N-(4-bromophenyl)sulfonyl-3-methylbutanamide |
| InChIKey | YHMHTNHUCODKGY-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)NS(=O)(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)