CAS 27905-45-9 appears in our catalog under these names: 1H,1H,2H,2H-Heptadecafluorodecyl acrylate, 97%, (Perfluorooctyl)ethyl Acrylate, >95% (GC), 1H,1H,2H,2H-Perfluorodecyl acrylate, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10–Heptadecafluorodecyl acrylate, 1H,1H,2H,2H-Heptadecafluorodecyl-1-acrylate (stabilized with BHT + TBC). Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio, Biosynth. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 100mg, 50g, 250g.
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl prop-2-enoate (CAS 27905-45-9) is a chemical compound with the molecular formula C13H7F17O2 and a molecular weight of 518.17 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl prop-2-enoate. InChIKey: QUKRIOLKOHUUBM-UHFFFAOYSA-N.
| Molecular formula | C13H7F17O2 |
|---|---|
| Molecular weight | 518.17 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl prop-2-enoate |
| InChIKey | QUKRIOLKOHUUBM-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)