CAS 27906-23-6 is the registry number for Acetic acid, 2-(2-chloro-4-nitrophenoxy)-, ethyl ester, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Ethyl 2-(2-chloro-4-nitrophenoxy)acetate (CAS 27906-23-6) is a chemical compound with the molecular formula C10H10ClNO5 and a molecular weight of 259.64 g/mol. IUPAC name: ethyl 2-(2-chloro-4-nitrophenoxy)acetate. InChIKey: ZWLVUFOLWZHSCA-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO5 |
|---|---|
| Molecular weight | 259.64 g/mol |
| IUPAC name | ethyl 2-(2-chloro-4-nitrophenoxy)acetate |
| InChIKey | ZWLVUFOLWZHSCA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC1=C(C=C(C=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)