CAS 2791272-15-4 is the registry number for 8-Bromo-7-fluoronaphthalene-1,3-diol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-7-fluoronaphthalene-1,3-diol (CAS 2791272-15-4) is a chemical compound with the molecular formula C10H6BrFO2 and a molecular weight of 257.06 g/mol. IUPAC name: 8-bromo-7-fluoronaphthalene-1,3-diol. InChIKey: LYBYDINMMUFPKP-UHFFFAOYSA-N.
| Molecular formula | C10H6BrFO2 |
|---|---|
| Molecular weight | 257.06 g/mol |
| IUPAC name | 8-bromo-7-fluoronaphthalene-1,3-diol |
| InChIKey | LYBYDINMMUFPKP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C(C=C(C=C21)O)O)Br)F |
Computed by PubChem (NCBI)