Products 2791272-45-0

CAS 2791272-45-0 is the registry number for 8-Chloro-7-fluoro-1,3-dihydroxy-2-naphthoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

8-chloro-7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid (CAS 2791272-45-0) is a chemical compound with the molecular formula C11H6ClFO4 and a molecular weight of 256.61 g/mol. IUPAC name: 8-chloro-7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid. InChIKey: QVLPALIUGCSJEM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H6ClFO4
Molecular weight256.61 g/mol
IUPAC name8-chloro-7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid
InChIKeyQVLPALIUGCSJEM-UHFFFAOYSA-N
SMILESC1=CC(=C(C2=C(C(=C(C=C21)O)C(=O)O)O)Cl)F

Computed by PubChem (NCBI)