CAS 2791272-50-7 is the registry number for (S)-2-Thia-1,3,7-triazaspiro[4.5]decane 2,2-dioxide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(5S)-2lambda6-thia-1,3,9-triazaspiro[4.5]decane 2,2-dioxide (CAS 2791272-50-7) is a chemical compound with the molecular formula C6H13N3O2S and a molecular weight of 191.25 g/mol. IUPAC name: (5S)-2lambda6-thia-1,3,9-triazaspiro[4.5]decane 2,2-dioxide. InChIKey: KMNFDMVDOAMJTQ-LURJTMIESA-N.
| Molecular formula | C6H13N3O2S |
|---|---|
| Molecular weight | 191.25 g/mol |
| IUPAC name | (5S)-2lambda6-thia-1,3,9-triazaspiro[4.5]decane 2,2-dioxide |
| InChIKey | KMNFDMVDOAMJTQ-LURJTMIESA-N |
| SMILES | C1C[C@]2(CNC1)CNS(=O)(=O)N2 |
Computed by PubChem (NCBI)