CAS 2791282-32-9 is the registry number for (1S,2S,5R)-1-Hydroxy-2-isopropyl-5-methylcyclohexane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,2S,5R)-1-hydroxy-5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid (CAS 2791282-32-9) is a chemical compound with the molecular formula C11H20O3 and a molecular weight of 200.27 g/mol. IUPAC name: (1S,2S,5R)-1-hydroxy-5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid. InChIKey: YCAZRFVYTFVMGI-YWVKMMECSA-N.
| Molecular formula | C11H20O3 |
|---|---|
| Molecular weight | 200.27 g/mol |
| IUPAC name | (1S,2S,5R)-1-hydroxy-5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid |
| InChIKey | YCAZRFVYTFVMGI-YWVKMMECSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@](C1)(C(=O)O)O)C(C)C |
Computed by PubChem (NCBI)