CAS 2792143-56-5 is the registry number for (R)-(4,4-Difluoro-5-oxopyrrolidin-2-yl)methyl 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R)-4,4-difluoro-5-oxopyrrolidin-2-yl]methyl 4-methylbenzenesulfonate (CAS 2792143-56-5) is a chemical compound with the molecular formula C12H13F2NO4S and a molecular weight of 305.30 g/mol. IUPAC name: [(2R)-4,4-difluoro-5-oxopyrrolidin-2-yl]methyl 4-methylbenzenesulfonate. InChIKey: OFLJSWFEBFHZAZ-SECBINFHSA-N.
| Molecular formula | C12H13F2NO4S |
|---|---|
| Molecular weight | 305.30 g/mol |
| IUPAC name | [(2R)-4,4-difluoro-5-oxopyrrolidin-2-yl]methyl 4-methylbenzenesulfonate |
| InChIKey | OFLJSWFEBFHZAZ-SECBINFHSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@H]2CC(C(=O)N2)(F)F |
Computed by PubChem (NCBI)