CAS 2792143-80-5 is the registry number for tert-Butyl 3-iodo-6-methyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-iodo-6-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate (CAS 2792143-80-5) is a chemical compound with the molecular formula C11H16IN3O2 and a molecular weight of 349.17 g/mol. IUPAC name: tert-butyl 3-iodo-6-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate. InChIKey: FYQPWARETAHWBO-UHFFFAOYSA-N.
| Molecular formula | C11H16IN3O2 |
|---|---|
| Molecular weight | 349.17 g/mol |
| IUPAC name | tert-butyl 3-iodo-6-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate |
| InChIKey | FYQPWARETAHWBO-UHFFFAOYSA-N |
| SMILES | CC1C2=C(CN1C(=O)OC(C)(C)C)C(=NN2)I |
Computed by PubChem (NCBI)