CAS 2792169-39-0 is the registry number for 5-Isopropylbenzene-1,2,3-triamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-propan-2-ylbenzene-1,2,3-triamine (CAS 2792169-39-0) is a chemical compound with the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. IUPAC name: 5-propan-2-ylbenzene-1,2,3-triamine. InChIKey: OVSVRIGGANMUCZ-UHFFFAOYSA-N.
| Molecular formula | C9H15N3 |
|---|---|
| Molecular weight | 165.24 g/mol |
| IUPAC name | 5-propan-2-ylbenzene-1,2,3-triamine |
| InChIKey | OVSVRIGGANMUCZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)N)N)N |
Computed by PubChem (NCBI)