Products 279262-23-6

CAS 279262-23-6 appears in our catalog under these names: 4-(4-Morpholinylmethyl)phenylboronic acid, 96%, 4–(Morpholinomethyl)phenylboronic acid, 4-(Morpholinomethyl)phenylboronic Acid (contains varying amounts of Anhydride), (4-(Morpholin-4-ylmethyl)phenyl)boronic acid hydrochloride, 4-(Morpholinomethyl)phenylboronic acid 98%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 1g, 25g, 10g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

[4-(morpholin-4-ylmethyl)phenyl]boronic acid (CAS 279262-23-6) is a chemical compound with the molecular formula C11H16BNO3 and a molecular weight of 221.06 g/mol. IUPAC name: [4-(morpholin-4-ylmethyl)phenyl]boronic acid. InChIKey: QPFDUULIDNELSE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16BNO3
Molecular weight221.06 g/mol
IUPAC name[4-(morpholin-4-ylmethyl)phenyl]boronic acid
InChIKeyQPFDUULIDNELSE-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)CN2CCOCC2)(O)O

Computed by PubChem (NCBI)