Products 27930-45-6
CAS 27930-45-6 is the registry number for Alprostadil (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoate (CAS 27930-45-6) is a chemical compound with the molecular formula C20H33NaO5 and a molecular weight of 376.5 g/mol. IUPAC name: sodium 7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoate. InChIKey: BMHCMWOSEOFUFU-HZTJSMSYSA-M.
| Molecular formula | C20H33NaO5 |
|---|---|
| Molecular weight | 376.5 g/mol |
| IUPAC name | sodium 7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoate |
| InChIKey | BMHCMWOSEOFUFU-HZTJSMSYSA-M |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@@H](CC(=O)[C@@H]1CCCCCCC(=O)[O-])O)O.[Na+] |
Computed by PubChem (NCBI)