CAS 2794197-18-3 is the registry number for N-(5-Bromo-3-(methylthio)pyridin-2-yl)pivalamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(5-bromo-3-methylsulfanyl-2-pyridinyl)-2,2-dimethylpropanamide (CAS 2794197-18-3) is a chemical compound with the molecular formula C11H15BrN2OS and a molecular weight of 303.22 g/mol. IUPAC name: N-(5-bromo-3-methylsulfanyl-2-pyridinyl)-2,2-dimethylpropanamide. InChIKey: WWOYRLUDJKXSRZ-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2OS |
|---|---|
| Molecular weight | 303.22 g/mol |
| IUPAC name | N-(5-bromo-3-methylsulfanyl-2-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | WWOYRLUDJKXSRZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=C(C=N1)Br)SC |
Computed by PubChem (NCBI)