CAS 2795110-46-0 is the registry number for Methyl 4-bromo-1-(4-methoxybenzyl)-1H-1,2,3-triazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-bromo-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate (CAS 2795110-46-0) is a chemical compound with the molecular formula C12H12BrN3O3 and a molecular weight of 326.15 g/mol. IUPAC name: methyl 5-bromo-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate. InChIKey: LARAKSJRTZXDFK-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN3O3 |
|---|---|
| Molecular weight | 326.15 g/mol |
| IUPAC name | methyl 5-bromo-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate |
| InChIKey | LARAKSJRTZXDFK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C(=C(N=N2)Br)C(=O)OC |
Computed by PubChem (NCBI)