Products 2795269-24-6

CAS 2795269-24-6 is the registry number for 1-(Fluoromethyl)-3,3-dimethoxycyclobutane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-(fluoromethyl)-3,3-dimethoxycyclobutane-1-carboxylic acid (CAS 2795269-24-6) is a chemical compound with the molecular formula C8H13FO4 and a molecular weight of 192.18 g/mol. IUPAC name: 1-(fluoromethyl)-3,3-dimethoxycyclobutane-1-carboxylic acid. InChIKey: XHWCHPTYJVOHMG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13FO4
Molecular weight192.18 g/mol
IUPAC name1-(fluoromethyl)-3,3-dimethoxycyclobutane-1-carboxylic acid
InChIKeyXHWCHPTYJVOHMG-UHFFFAOYSA-N
SMILESCOC1(CC(C1)(CF)C(=O)O)OC

Computed by PubChem (NCBI)