CAS 27953-22-6 is the registry number for N-Ethyl-n-(3-nitrobenzyl)ethanamine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-ethyl-N-[(3-nitrophenyl)methyl]ethanamine;hydrobromide (CAS 27953-22-6) is a chemical compound with the molecular formula C11H17BrN2O2 and a molecular weight of 289.17 g/mol. IUPAC name: N-ethyl-N-[(3-nitrophenyl)methyl]ethanamine;hydrobromide. InChIKey: NLTNDFOUFPPMIQ-UHFFFAOYSA-N.
| Molecular formula | C11H17BrN2O2 |
|---|---|
| Molecular weight | 289.17 g/mol |
| IUPAC name | N-ethyl-N-[(3-nitrophenyl)methyl]ethanamine;hydrobromide |
| InChIKey | NLTNDFOUFPPMIQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC1=CC(=CC=C1)[N+](=O)[O-].Br |
Computed by PubChem (NCBI)