CAS 27954-37-6 is the registry number for 1,1-dimethyl-3-(3-(1,1,2,2-tetrafluoroethoxy)phenyl)urea. Offered by: TRC. Available pack sizes: 750mg.
1,1-dimethyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]urea (CAS 27954-37-6) is a chemical compound with the molecular formula C11H12F4N2O2 and a molecular weight of 280.22 g/mol. IUPAC name: 1,1-dimethyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]urea. InChIKey: FCAKZZMVXCLLHM-UHFFFAOYSA-N.
| Molecular formula | C11H12F4N2O2 |
|---|---|
| Molecular weight | 280.22 g/mol |
| IUPAC name | 1,1-dimethyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]urea |
| InChIKey | FCAKZZMVXCLLHM-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)NC1=CC(=CC=C1)OC(C(F)F)(F)F |
Computed by PubChem (NCBI)