Products 27958-92-5
CAS 27958-92-5 appears in our catalog under these names: Diethyl(3-nitrobenzyl)amine, 95%, N-Ethyl-N-(3-nitrobenzyl)ethanamine hydrobromide, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g.
N-ethyl-N-[(3-nitrophenyl)methyl]ethanamine (CAS 27958-92-5) is a chemical compound with the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. IUPAC name: N-ethyl-N-[(3-nitrophenyl)methyl]ethanamine. InChIKey: PRWBWWISPHBPIA-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | N-ethyl-N-[(3-nitrophenyl)methyl]ethanamine |
| InChIKey | PRWBWWISPHBPIA-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)