CAS 2797-28-6 is the registry number for Tetrakis(pentafluorophenyl)-borate lithium (1:1). Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.
Lithium tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (CAS 2797-28-6) is a chemical compound with the molecular formula C24BF20Li and a molecular weight of 686.0 g/mol. IUPAC name: lithium tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide. InChIKey: WTTFKRRTEAPVBI-UHFFFAOYSA-N.
| Molecular formula | C24BF20Li |
|---|---|
| Molecular weight | 686.0 g/mol |
| IUPAC name | lithium tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| InChIKey | WTTFKRRTEAPVBI-UHFFFAOYSA-N |
| SMILES | [Li+].[B-](C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F |
Computed by PubChem (NCBI)