CAS 27973-30-4 is the registry number for Pyrene-1,6-dicarbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Pyrene-1,6-dicarbonitrile (CAS 27973-30-4) is a chemical compound with the molecular formula C18H8N2 and a molecular weight of 252.3 g/mol. IUPAC name: pyrene-1,6-dicarbonitrile. InChIKey: SPRPKGVDKIILTH-UHFFFAOYSA-N.
| Molecular formula | C18H8N2 |
|---|---|
| Molecular weight | 252.3 g/mol |
| IUPAC name | pyrene-1,6-dicarbonitrile |
| InChIKey | SPRPKGVDKIILTH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC3=C4C2=C1C=CC4=C(C=C3)C#N)C#N |
Computed by PubChem (NCBI)