CAS 2799640-68-7 is the registry number for 3,4-Difluoro-2-[(phenylseleno)methyl]benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3,4-difluoro-2-(phenylselanylmethyl)benzoic acid (CAS 2799640-68-7) is a chemical compound with the molecular formula C14H10F2O2Se and a molecular weight of 327.19 g/mol. IUPAC name: 3,4-difluoro-2-(phenylselanylmethyl)benzoic acid. InChIKey: QBNVDZNXSXEEFL-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2Se |
|---|---|
| Molecular weight | 327.19 g/mol |
| IUPAC name | 3,4-difluoro-2-(phenylselanylmethyl)benzoic acid |
| InChIKey | QBNVDZNXSXEEFL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Se]CC2=C(C=CC(=C2F)F)C(=O)O |
Computed by PubChem (NCBI)