CAS 27999-47-9 appears in our catalog under these names: 5'-O-(p-Toluenesulfonyl)-2'-deoxyuridine, 2'-Deoxy-5'-O-p-toluenesulfonyluridine. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 25mg, 50mg, 2g, 1g, 5g.
[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 4-methylbenzenesulfonate (CAS 27999-47-9) is a chemical compound with the molecular formula C16H18N2O7S and a molecular weight of 382.4 g/mol. IUPAC name: [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 4-methylbenzenesulfonate. InChIKey: CNGFNNCQXVJZDZ-GZBFAFLISA-N.
| Molecular formula | C16H18N2O7S |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
| InChIKey | CNGFNNCQXVJZDZ-GZBFAFLISA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H]2[C@H](C[C@@H](O2)N3C=CC(=O)NC3=O)O |
Computed by PubChem (NCBI)