Products 27999-97-9

CAS 27999-97-9 is the registry number for Tetrahydro-2h-thiopyran-4-yl 4-methylbenzenesulfonate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Thian-4-yl 4-methylbenzenesulfonate (CAS 27999-97-9) is a chemical compound with the molecular formula C12H16O3S2 and a molecular weight of 272.4 g/mol. IUPAC name: thian-4-yl 4-methylbenzenesulfonate. InChIKey: GDJWDLUJZROSRN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O3S2
Molecular weight272.4 g/mol
IUPAC namethian-4-yl 4-methylbenzenesulfonate
InChIKeyGDJWDLUJZROSRN-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OC2CCSCC2

Computed by PubChem (NCBI)