Products 2800837-74-3
CAS 2800837-74-3 is the registry number for 1-(tert-Butyl) 4-methyl (S)-2-oxoimidazolidine-1,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 4-O-methyl (4S)-2-oxoimidazolidine-1,4-dicarboxylate (CAS 2800837-74-3) is a chemical compound with the molecular formula C10H16N2O5 and a molecular weight of 244.24 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl (4S)-2-oxoimidazolidine-1,4-dicarboxylate. InChIKey: ZKUBRZMFFFGDFB-LURJTMIESA-N.
| Molecular formula | C10H16N2O5 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl (4S)-2-oxoimidazolidine-1,4-dicarboxylate |
| InChIKey | ZKUBRZMFFFGDFB-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](NC1=O)C(=O)OC |
Computed by PubChem (NCBI)