CAS 2801182-08-9 is the registry number for Fmoc-L-TfThr-OH (2S,3S). Offered by: Iris Biotech. Available pack sizes: 100mg, 250mg, 1g.
(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluoro-3-hydroxybutanoic acid (CAS 2801182-08-9) is a chemical compound with the molecular formula C19H16F3NO5 and a molecular weight of 395.3 g/mol. IUPAC name: (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluoro-3-hydroxybutanoic acid. InChIKey: SNMKUIIKPNRXOJ-HOTGVXAUSA-N.
| Molecular formula | C19H16F3NO5 |
|---|---|
| Molecular weight | 395.3 g/mol |
| IUPAC name | (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluoro-3-hydroxybutanoic acid |
| InChIKey | SNMKUIIKPNRXOJ-HOTGVXAUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H]([C@@H](C(F)(F)F)O)C(=O)O |
Computed by PubChem (NCBI)