Products 28025-77-6

CAS 28025-77-6 is the registry number for 3-Morpholinopropanoic acid hydrobromide 95+%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-morpholin-4-ylpropanoic acid;hydrobromide (CAS 28025-77-6) is a chemical compound with the molecular formula C7H14BrNO3 and a molecular weight of 240.09 g/mol. IUPAC name: 3-morpholin-4-ylpropanoic acid;hydrobromide. InChIKey: OIVBLJJLNWEDOU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14BrNO3
Molecular weight240.09 g/mol
IUPAC name3-morpholin-4-ylpropanoic acid;hydrobromide
InChIKeyOIVBLJJLNWEDOU-UHFFFAOYSA-N
SMILESC1COCCN1CCC(=O)O.Br

Computed by PubChem (NCBI)