Products 2803211-90-5
CAS 2803211-90-5 is the registry number for Boc-(2R,3R)-2-methyl-3-carboxymorpholine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-3-carboxylic acid (CAS 2803211-90-5) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2R,3R)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-3-carboxylic acid. InChIKey: XUJUXKBCUVWHIX-HTQZYQBOSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2R,3R)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-3-carboxylic acid |
| InChIKey | XUJUXKBCUVWHIX-HTQZYQBOSA-N |
| SMILES | C[C@@H]1[C@@H](N(CCO1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)