Products 2803283-48-7
CAS 2803283-48-7 is the registry number for tert-Butyl (3-chloro-4,5-bis(trifluoromethyl)phenyl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[3-chloro-4,5-bis(trifluoromethyl)phenyl]carbamate (CAS 2803283-48-7) is a chemical compound with the molecular formula C13H12ClF6NO2 and a molecular weight of 363.68 g/mol. IUPAC name: tert-butyl N-[3-chloro-4,5-bis(trifluoromethyl)phenyl]carbamate. InChIKey: ZFNLMFSKACGFJU-UHFFFAOYSA-N.
| Molecular formula | C13H12ClF6NO2 |
|---|---|
| Molecular weight | 363.68 g/mol |
| IUPAC name | tert-butyl N-[3-chloro-4,5-bis(trifluoromethyl)phenyl]carbamate |
| InChIKey | ZFNLMFSKACGFJU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C(=C1)Cl)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)