CAS 2803283-90-9 is the registry number for tert-Butyl (7-chloro-4-iodobenzo[d]thiazol-2-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(7-chloro-4-iodo-1,3-benzothiazol-2-yl)carbamate (CAS 2803283-90-9) is a chemical compound with the molecular formula C12H12ClIN2O2S and a molecular weight of 410.66 g/mol. IUPAC name: tert-butyl N-(7-chloro-4-iodo-1,3-benzothiazol-2-yl)carbamate. InChIKey: KYRRAAUOQXRDSU-UHFFFAOYSA-N.
| Molecular formula | C12H12ClIN2O2S |
|---|---|
| Molecular weight | 410.66 g/mol |
| IUPAC name | tert-butyl N-(7-chloro-4-iodo-1,3-benzothiazol-2-yl)carbamate |
| InChIKey | KYRRAAUOQXRDSU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC2=C(C=CC(=C2S1)Cl)I |
Computed by PubChem (NCBI)