CAS 2803370-09-2 appears in our catalog under these names: (S)-4,4-Dimethylpentan-2-amine (2S,3S)-2,3-dihydroxysuccinate, 98%, 98%, (S)-4,4-Dimethylpentan-2-amine (2S,3S)-2,3-dihydroxysuccinate, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 5g, 25g, 100g.
(2S,3S)-2,3-dihydroxybutanedioic acid;(2S)-4,4-dimethylpentan-2-amine (CAS 2803370-09-2) is a chemical compound with the molecular formula C11H23NO6 and a molecular weight of 265.30 g/mol. IUPAC name: (2S,3S)-2,3-dihydroxybutanedioic acid;(2S)-4,4-dimethylpentan-2-amine. InChIKey: XXYYUXSAVGJZEJ-TVHYDSGVSA-N.
| Molecular formula | C11H23NO6 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2S,3S)-2,3-dihydroxybutanedioic acid;(2S)-4,4-dimethylpentan-2-amine |
| InChIKey | XXYYUXSAVGJZEJ-TVHYDSGVSA-N |
| SMILES | C[C@@H](CC(C)(C)C)N.[C@H]([C@@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)